C16H16F4N6O2S — CID 139521241
N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-3-fluoroazetidine-3-carboxamide (PubChem CID 139521241) has the molecular formula C16H16F4N6O2S and a molecular weight of 432.40 g/mol. Its IUPAC name is N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-3-fluoroazetidine-3-carboxamide.
| Compound Name | N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-3-fluoroazetidine-3-carboxamide |
|---|---|
| PubChem CID | 139521241 |
| Molecular Formula | C16H16F4N6O2S |
| Molecular Weight | 432.40 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-3-fluoroazetidine-3-carboxamide |
| SMILES | N/C(=N\c1ccc(F)c(C(F)F)c1)c1nonc1SCCNC(=O)C1(F)CNC1 |
| InChI | InChI=1S/C16H16F4N6O2S/c17-10-2-1-8(5-9(10)12(18)19)24-13(21)11-14(26-28-25-11)29-4-3-23-15(27)16(20)6-22-7-16/h1-2,5,12,22H,3-4,6-7H2,(H2,21,24)(H,23,27) |
| InChIKey | VZWUDAQJPRAKMR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 118.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|