C13H14BrFN6O4S2 — CID 142341909
N-[2-[[4-[N'-(3-bromo-2-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide (PubChem CID 142341909) has the molecular formula C13H14BrFN6O4S2 and a molecular weight of 481.33 g/mol. Its IUPAC name is N-[2-[[4-[N'-(3-bromo-2-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide.
| Compound Name | N-[2-[[4-[N'-(3-bromo-2-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide |
|---|---|
| PubChem CID | 142341909 |
| Molecular Formula | C13H14BrFN6O4S2 |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 479.97 |
| IUPAC Name | N-[2-[[4-[N'-(3-bromo-2-fluorophenyl)carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide |
| SMILES | N/C(=N\c1cccc(Br)c1F)c1nonc1SCCNC(=O)CS(N)(=O)=O |
| InChI | InChI=1S/C13H14BrFN6O4S2/c14-7-2-1-3-8(10(7)15)19-12(16)11-13(21-25-20-11)26-5-4-18-9(22)6-27(17,23)24/h1-3H,4-6H2,(H2,16,19)(H,18,22)(H2,17,23,24) |
| InChIKey | ZMEFZDPFJFYLBR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|