C15H19FN6O4S2 — CID 139520597
N-[2-[[4-[N-[3-(fluoromethyl)phenyl]-N'-methylcarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide (PubChem CID 139520597) has the molecular formula C15H19FN6O4S2 and a molecular weight of 430.49 g/mol. Its IUPAC name is N-[2-[[4-[N-[3-(fluoromethyl)phenyl]-N'-methylcarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide.
| Compound Name | N-[2-[[4-[N-[3-(fluoromethyl)phenyl]-N'-methylcarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide |
|---|---|
| PubChem CID | 139520597 |
| Molecular Formula | C15H19FN6O4S2 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-[2-[[4-[N-[3-(fluoromethyl)phenyl]-N'-methylcarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-2-sulfamoylacetamide |
| SMILES | C/N=C(/Nc1cccc(CF)c1)c1nonc1SCCNC(=O)CS(N)(=O)=O |
| InChI | InChI=1S/C15H19FN6O4S2/c1-18-14(20-11-4-2-3-10(7-11)8-16)13-15(22-26-21-13)27-6-5-19-12(23)9-28(17,24)25/h2-4,7H,5-6,8-9H2,1H3,(H,18,20)(H,19,23)(H2,17,24,25) |
| InChIKey | NIIIRKADKXOSLS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 152.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|