C20H15F6N5O2S — CID 139520707
N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-4-(trifluoromethyl)benzamide (PubChem CID 139520707) has the molecular formula C20H15F6N5O2S and a molecular weight of 503.43 g/mol. Its IUPAC name is N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 139520707 |
| Molecular Formula | C20H15F6N5O2S |
| Molecular Weight | 503.43 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | N-[2-[[4-[N'-[3-(difluoromethyl)-4-fluorophenyl]carbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]ethyl]-4-(trifluoromethyl)benzamide |
| SMILES | N/C(=N\c1ccc(F)c(C(F)F)c1)c1nonc1SCCNC(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H15F6N5O2S/c21-14-6-5-12(9-13(14)16(22)23)29-17(27)15-19(31-33-30-15)34-8-7-28-18(32)10-1-3-11(4-2-10)20(24,25)26/h1-6,9,16H,7-8H2,(H2,27,29)(H,28,32) |
| InChIKey | MRLGZUWSEOIQGH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|