C13H14BrFN8OS — CID 142280291
4-[2-[[amino-[(Z)-aminomethylideneamino]methylidene]amino]ethylsulfanyl]-N'-(3-bromo-4-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 142280291) has the molecular formula C13H14BrFN8OS and a molecular weight of 429.28 g/mol. Its IUPAC name is 4-[2-[[amino-[(Z)-aminomethylideneamino]methylidene]amino]ethylsulfanyl]-N'-(3-bromo-4-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[2-[[amino-[(Z)-aminomethylideneamino]methylidene]amino]ethylsulfanyl]-N'-(3-bromo-4-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 142280291 |
| Molecular Formula | C13H14BrFN8OS |
| Molecular Weight | 429.28 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 4-[2-[[amino-[(Z)-aminomethylideneamino]methylidene]amino]ethylsulfanyl]-N'-(3-bromo-4-fluorophenyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C=N\C(N)=N\CCSc1nonc1/C(N)=N/c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H14BrFN8OS/c14-8-5-7(1-2-9(8)15)21-11(17)10-12(23-24-22-10)25-4-3-19-13(18)20-6-16/h1-2,5-6H,3-4H2,(H2,17,21)(H4,16,18,19,20) |
| InChIKey | DVIUEQAWYZMSEQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 154.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|