C14H14BrF4N7O4S2 — CID 137419563
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[[methanesulfonamido-(trifluoromethylamino)methylidene]amino]ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137419563) has the molecular formula C14H14BrF4N7O4S2 and a molecular weight of 564.34 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[[methanesulfonamido-(trifluoromethylamino)methylidene]amino]ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[[methanesulfonamido-(trifluoromethylamino)methylidene]amino]ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137419563 |
| Molecular Formula | C14H14BrF4N7O4S2 |
| Molecular Weight | 564.34 g/mol |
| Exact Mass | 562.97 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-[[methanesulfonamido-(trifluoromethylamino)methylidene]amino]ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)N/C(=N/CCSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO)NC(F)(F)F |
| InChI | InChI=1S/C14H14BrF4N7O4S2/c1-32(28,29)26-13(22-14(17,18)19)20-4-5-31-12-10(24-30-25-12)11(23-27)21-7-2-3-9(16)8(15)6-7/h2-3,6,27H,4-5H2,1H3,(H,21,23)(H2,20,22,26) |
| InChIKey | YVCLFNKJBITCHV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|