C16H18BrFN4O4S — CID 159094128
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(5-hydroxy-5-methyl-2-oxohexyl)sulfanyl-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 159094128) has the molecular formula C16H18BrFN4O4S and a molecular weight of 461.31 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(5-hydroxy-5-methyl-2-oxohexyl)sulfanyl-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(5-hydroxy-5-methyl-2-oxohexyl)sulfanyl-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 159094128 |
| Molecular Formula | C16H18BrFN4O4S |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(5-hydroxy-5-methyl-2-oxohexyl)sulfanyl-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(C)(O)CCC(=O)CSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C16H18BrFN4O4S/c1-16(2,24)6-5-10(23)8-27-15-13(21-26-22-15)14(20-25)19-9-3-4-12(18)11(17)7-9/h3-4,7,24-25H,5-6,8H2,1-2H3,(H,19,20) |
| InChIKey | KCLDUZTWVLSYKI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|