C13H15BrFN5O5S2 — CID 137360268
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-hydroxy-2-(methanesulfonamido)propyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137360268) has the molecular formula C13H15BrFN5O5S2 and a molecular weight of 484.33 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-hydroxy-2-(methanesulfonamido)propyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-hydroxy-2-(methanesulfonamido)propyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137360268 |
| Molecular Formula | C13H15BrFN5O5S2 |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 482.97 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[3-hydroxy-2-(methanesulfonamido)propyl]sulfanyl-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)NC(CO)CSc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C13H15BrFN5O5S2/c1-27(23,24)20-8(5-21)6-26-13-11(18-25-19-13)12(17-22)16-7-2-3-10(15)9(14)4-7/h2-4,8,20-22H,5-6H2,1H3,(H,16,17) |
| InChIKey | XBUJAMVEKDIQJU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 149.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|