C13H15FN6O4S2 — CID 137297237
N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137297237) has the molecular formula C13H15FN6O4S2 and a molecular weight of 402.43 g/mol. Its IUPAC name is N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137297237 |
| Molecular Formula | C13H15FN6O4S2 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-[2-(sulfamoylamino)ethylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)NCCSc1nonc1/C(=N/C1Cc2ccc(F)cc21)NO |
| InChI | InChI=1S/C13H15FN6O4S2/c14-8-2-1-7-5-10(9(7)6-8)17-12(18-21)11-13(20-24-19-11)25-4-3-16-26(15,22)23/h1-2,6,10,16,21H,3-5H2,(H,17,18)(H2,15,22,23) |
| InChIKey | CPQMBQRMRWSZRB-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 155.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|