C14H14FN5O2S — CID 137297232
4-(azetidin-3-ylsulfanyl)-N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137297232) has the molecular formula C14H14FN5O2S and a molecular weight of 335.36 g/mol. Its IUPAC name is 4-(azetidin-3-ylsulfanyl)-N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-(azetidin-3-ylsulfanyl)-N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137297232 |
| Molecular Formula | C14H14FN5O2S |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-(azetidin-3-ylsulfanyl)-N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\C1Cc2ccc(F)cc21)c1nonc1SC1CNC1 |
| InChI | InChI=1S/C14H14FN5O2S/c15-8-2-1-7-3-11(10(7)4-8)17-13(18-21)12-14(20-22-19-12)23-9-5-16-6-9/h1-2,4,9,11,16,21H,3,5-6H2,(H,17,18) |
| InChIKey | QMGMPOKPFPGTAM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|