C11H9FN4O2 — CID 166058889
N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 166058889) has the molecular formula C11H9FN4O2 and a molecular weight of 248.22 g/mol. Its IUPAC name is N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 166058889 |
| Molecular Formula | C11H9FN4O2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\[C@H]1Cc2ccc(F)cc21)c1cnon1 |
| InChI | InChI=1S/C11H9FN4O2/c12-7-2-1-6-3-9(8(6)4-7)14-11(15-17)10-5-13-18-16-10/h1-2,4-5,9,17H,3H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | IFLUPGYYOATQGD-VIFPVBQESA-N |
| XLogP | 1.23 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|