C16H18FN5O5 — CID 146457383
2-[[4-[N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]-N-[(2S)-1-hydroxypropan-2-yl]acetamide (PubChem CID 146457383) has the molecular formula C16H18FN5O5 and a molecular weight of 379.35 g/mol. Its IUPAC name is 2-[[4-[N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]-N-[(2S)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-[[4-[N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 146457383 |
| Molecular Formula | C16H18FN5O5 |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[[4-[N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@@H](CO)NC(=O)COc1nonc1/C(=N/[C@H]1Cc2ccc(F)cc21)NO |
| InChI | InChI=1S/C16H18FN5O5/c1-8(6-23)18-13(24)7-26-16-14(21-27-22-16)15(20-25)19-12-4-9-2-3-10(17)5-11(9)12/h2-3,5,8,12,23,25H,4,6-7H2,1H3,(H,18,24)(H,19,20)/t8-,12-/m0/s1 |
| InChIKey | VBDUATKXBUGNKW-UFBFGSQYSA-N |
| XLogP | 0.11 |
| TPSA | 142.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|