C14H14FN5O3S — CID 137297481
2-[[4-[N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]-N-methylacetamide (PubChem CID 137297481) has the molecular formula C14H14FN5O3S and a molecular weight of 351.36 g/mol. Its IUPAC name is 2-[[4-[N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]-N-methylacetamide.
| Compound Name | 2-[[4-[N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]-N-methylacetamide |
|---|---|
| PubChem CID | 137297481 |
| Molecular Formula | C14H14FN5O3S |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[[4-[N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]sulfanyl]-N-methylacetamide |
| SMILES | CNC(=O)CSc1nonc1/C(=N/C1Cc2ccc(F)cc21)NO |
| InChI | InChI=1S/C14H14FN5O3S/c1-16-11(21)6-24-14-12(19-23-20-14)13(18-22)17-10-4-7-2-3-8(15)5-9(7)10/h2-3,5,10,22H,4,6H2,1H3,(H,16,21)(H,17,18) |
| InChIKey | GJCNXPFYQBVKFJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|