C14H15FN6O2S2 — CID 166855188
N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-(1,2,5-thiadiazolidin-3-ylmethylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 166855188) has the molecular formula C14H15FN6O2S2 and a molecular weight of 382.45 g/mol. Its IUPAC name is N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-(1,2,5-thiadiazolidin-3-ylmethylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-(1,2,5-thiadiazolidin-3-ylmethylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 166855188 |
| Molecular Formula | C14H15FN6O2S2 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-(1,2,5-thiadiazolidin-3-ylmethylsulfanyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\C1Cc2ccc(F)cc21)c1nonc1SCC1CNSN1 |
| InChI | InChI=1S/C14H15FN6O2S2/c15-8-2-1-7-3-11(10(7)4-8)17-13(18-22)12-14(20-23-19-12)24-6-9-5-16-25-21-9/h1-2,4,9,11,16,21-22H,3,5-6H2,(H,17,18) |
| InChIKey | CQDRUBBQTBOJGI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|