C16H20FN5O4S — CID 137293525
N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[4-(methylsulfonimidoyl)butoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137293525) has the molecular formula C16H20FN5O4S and a molecular weight of 397.43 g/mol. Its IUPAC name is N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[4-(methylsulfonimidoyl)butoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[4-(methylsulfonimidoyl)butoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137293525 |
| Molecular Formula | C16H20FN5O4S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N'-[(7S)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[4-(methylsulfonimidoyl)butoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)CCCCOc1nonc1/C(=N/[C@H]1Cc2ccc(F)cc21)NO |
| InChI | InChI=1S/C16H20FN5O4S/c1-27(18,24)7-3-2-6-25-16-14(21-26-22-16)15(20-23)19-13-8-10-4-5-11(17)9-12(10)13/h4-5,9,13,18,23H,2-3,6-8H2,1H3,(H,19,20)/t13-,27?/m0/s1 |
| InChIKey | KOLBGLKSEBFHCG-NGXIVSIZSA-N |
| XLogP | 2.07 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|