C18H15FN4O3S — CID 157206772
N'-[(7R)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[(5-oxocyclohexa-1,3-dien-1-yl)methylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 157206772) has the molecular formula C18H15FN4O3S and a molecular weight of 386.41 g/mol. Its IUPAC name is N'-[(7R)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[(5-oxocyclohexa-1,3-dien-1-yl)methylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[(7R)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[(5-oxocyclohexa-1,3-dien-1-yl)methylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 157206772 |
| Molecular Formula | C18H15FN4O3S |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N'-[(7R)-4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl]-N-hydroxy-4-[(5-oxocyclohexa-1,3-dien-1-yl)methylsulfanyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=C1C=CC=C(CSc2nonc2/C(=N/[C@@H]2Cc3ccc(F)cc32)NO)C1 |
| InChI | InChI=1S/C18H15FN4O3S/c19-12-5-4-11-7-15(14(11)8-12)20-17(21-25)16-18(23-26-22-16)27-9-10-2-1-3-13(24)6-10/h1-5,8,15,25H,6-7,9H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | PZCBSHVQZIAUEJ-OAHLLOKOSA-N |
| XLogP | 2.78 |
| TPSA | 100.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|