C15H17FN6O3S — CID 154030848
N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-[(1-imino-1-oxothietan-3-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 154030848) has the molecular formula C15H17FN6O3S and a molecular weight of 380.41 g/mol. Its IUPAC name is N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-[(1-imino-1-oxothietan-3-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-[(1-imino-1-oxothietan-3-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 154030848 |
| Molecular Formula | C15H17FN6O3S |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N'-(4-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-4-[(1-imino-1-oxothietan-3-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S1(=O)CC(CNc2nonc2/C(=N/C2Cc3ccc(F)cc32)NO)C1 |
| InChI | InChI=1S/C15H17FN6O3S/c16-10-2-1-9-3-12(11(9)4-10)19-15(20-23)13-14(22-25-21-13)18-5-8-6-26(17,24)7-8/h1-2,4,8,12,17,23H,3,5-7H2,(H,18,22)(H,19,20) |
| InChIKey | IRQFTFFBXJCELU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|