C15H18FN5O4 — CID 137297476
4-[(2,3-dihydroxy-2-methylpropyl)amino]-N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137297476) has the molecular formula C15H18FN5O4 and a molecular weight of 351.34 g/mol. Its IUPAC name is 4-[(2,3-dihydroxy-2-methylpropyl)amino]-N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[(2,3-dihydroxy-2-methylpropyl)amino]-N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137297476 |
| Molecular Formula | C15H18FN5O4 |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-[(2,3-dihydroxy-2-methylpropyl)amino]-N'-(2-fluoro-7-bicyclo[4.2.0]octa-1(6),2,4-trienyl)-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(O)(CO)CNc1nonc1/C(=N/C1Cc2c(F)cccc21)NO |
| InChI | InChI=1S/C15H18FN5O4/c1-15(23,7-22)6-17-13-12(20-25-21-13)14(19-24)18-11-5-9-8(11)3-2-4-10(9)16/h2-4,11,22-24H,5-7H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | YIQLJINAZJWXNK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|