C12H14F2N6O4S — CID 139521126
N'-[3-(difluoromethyl)phenyl]-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 139521126) has the molecular formula C12H14F2N6O4S and a molecular weight of 376.35 g/mol. Its IUPAC name is N'-[3-(difluoromethyl)phenyl]-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[3-(difluoromethyl)phenyl]-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 139521126 |
| Molecular Formula | C12H14F2N6O4S |
| Molecular Weight | 376.35 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N'-[3-(difluoromethyl)phenyl]-4-[2-(sulfamoylamino)ethoxy]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | N/C(=N\c1cccc(C(F)F)c1)c1nonc1OCCNS(N)(=O)=O |
| InChI | InChI=1S/C12H14F2N6O4S/c13-10(14)7-2-1-3-8(6-7)18-11(15)9-12(20-24-19-9)23-5-4-17-25(16,21)22/h1-3,6,10,17H,4-5H2,(H2,15,18)(H2,16,21,22) |
| InChIKey | HDJSYGBZVQAWMR-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 158.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|