C13H16F3N3O3 — CID 38207270
5-(carbamoylamino)-N-[3-(trifluoromethoxy)phenyl]pentanamide (PubChem CID 38207270) has the molecular formula C13H16F3N3O3 and a molecular weight of 319.28 g/mol. Its IUPAC name is 5-(carbamoylamino)-N-[3-(trifluoromethoxy)phenyl]pentanamide.
| Compound Name | 5-(carbamoylamino)-N-[3-(trifluoromethoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 38207270 |
| Molecular Formula | C13H16F3N3O3 |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 5-(carbamoylamino)-N-[3-(trifluoromethoxy)phenyl]pentanamide |
| SMILES | NC(=O)NCCCCC(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H16F3N3O3/c14-13(15,16)22-10-5-3-4-9(8-10)19-11(20)6-1-2-7-18-12(17)21/h3-5,8H,1-2,6-7H2,(H,19,20)(H3,17,18,21) |
| InChIKey | NHFJJSOMTLYKHK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|