C12H16IN3O2 — CID 47114708
5-(carbamoylamino)-N-(3-iodophenyl)pentanamide (PubChem CID 47114708) has the molecular formula C12H16IN3O2 and a molecular weight of 361.18 g/mol. Its IUPAC name is 5-(carbamoylamino)-N-(3-iodophenyl)pentanamide.
| Compound Name | 5-(carbamoylamino)-N-(3-iodophenyl)pentanamide |
|---|---|
| PubChem CID | 47114708 |
| Molecular Formula | C12H16IN3O2 |
| Molecular Weight | 361.18 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 5-(carbamoylamino)-N-(3-iodophenyl)pentanamide |
| SMILES | NC(=O)NCCCCC(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C12H16IN3O2/c13-9-4-3-5-10(8-9)16-11(17)6-1-2-7-15-12(14)18/h3-5,8H,1-2,6-7H2,(H,16,17)(H3,14,15,18) |
| InChIKey | QFLXHZGSRLANJE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|