C17H23F3N2O5 — CID 171343840
N-(3-methoxyphenyl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide (PubChem CID 171343840) has the molecular formula C17H23F3N2O5 and a molecular weight of 392.37 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide.
| Compound Name | N-(3-methoxyphenyl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide |
|---|---|
| PubChem CID | 171343840 |
| Molecular Formula | C17H23F3N2O5 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-(3-methoxyphenyl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide |
| SMILES | COc1cccc(NC(=O)CCCCCCNC(=O)C(O)(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H23F3N2O5/c1-27-13-8-6-7-12(11-13)22-14(23)9-4-2-3-5-10-21-15(24)16(25,26)17(18,19)20/h6-8,11,25-26H,2-5,9-10H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | HJHYBPRGQFXQLP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|