C15H22N2O3 — CID 18154986
N-[3-(3-methoxyanilino)-3-oxopropyl]-2,2-dimethylpropanamide (PubChem CID 18154986) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[3-(3-methoxyanilino)-3-oxopropyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-(3-methoxyanilino)-3-oxopropyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18154986 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | N-[3-(3-methoxyanilino)-3-oxopropyl]-2,2-dimethylpropanamide |
| SMILES | COc1cccc(NC(=O)CCNC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-15(2,3)14(19)16-9-8-13(18)17-11-6-5-7-12(10-11)20-4/h5-7,10H,8-9H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | SKVCZIGSNGOZOE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |