C18H17ClFN5O2 — CID 135581924
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[(2-phenylethylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135581924) has the molecular formula C18H17ClFN5O2 and a molecular weight of 389.82 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[(2-phenylethylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[(2-phenylethylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135581924 |
| Molecular Formula | C18H17ClFN5O2 |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[(2-phenylethylamino)methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1nonc1CNCCc1ccccc1 |
| InChI | InChI=1S/C18H17ClFN5O2/c19-14-10-13(6-7-15(14)20)22-18(23-26)17-16(24-27-25-17)11-21-9-8-12-4-2-1-3-5-12/h1-7,10,21,26H,8-9,11H2,(H,22,23) |
| InChIKey | YQWGECSACRSMOC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|