C20H17ClF4N6O5S — CID 87869107
[[N-(3-chloro-4-fluorophenyl)-C-[4-[[2-(4-sulfamoylphenyl)ethylamino]methyl]-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 87869107) has the molecular formula C20H17ClF4N6O5S and a molecular weight of 564.91 g/mol. Its IUPAC name is [[N-(3-chloro-4-fluorophenyl)-C-[4-[[2-(4-sulfamoylphenyl)ethylamino]methyl]-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[N-(3-chloro-4-fluorophenyl)-C-[4-[[2-(4-sulfamoylphenyl)ethylamino]methyl]-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87869107 |
| Molecular Formula | C20H17ClF4N6O5S |
| Molecular Weight | 564.91 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | [[N-(3-chloro-4-fluorophenyl)-C-[4-[[2-(4-sulfamoylphenyl)ethylamino]methyl]-1,2,5-oxadiazol-3-yl]carbonimidoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | NS(=O)(=O)c1ccc(CCNCc2nonc2/C(=N/c2ccc(F)c(Cl)c2)NOC(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H17ClF4N6O5S/c21-14-9-12(3-6-15(14)22)28-18(31-35-19(32)20(23,24)25)17-16(29-36-30-17)10-27-8-7-11-1-4-13(5-2-11)37(26,33)34/h1-6,9,27H,7-8,10H2,(H,28,31)(H2,26,33,34) |
| InChIKey | IIFTYXFBMLMJGH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 161.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.91 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|