C16H18ClFN6O3 — CID 135693453
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[[2-(2-oxopyrrolidin-1-yl)ethylamino]methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135693453) has the molecular formula C16H18ClFN6O3 and a molecular weight of 396.81 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[[2-(2-oxopyrrolidin-1-yl)ethylamino]methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[[2-(2-oxopyrrolidin-1-yl)ethylamino]methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135693453 |
| Molecular Formula | C16H18ClFN6O3 |
| Molecular Weight | 396.81 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-[[2-(2-oxopyrrolidin-1-yl)ethylamino]methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | O=C1CCCN1CCNCc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C16H18ClFN6O3/c17-11-8-10(3-4-12(11)18)20-16(21-26)15-13(22-27-23-15)9-19-5-7-24-6-1-2-14(24)25/h3-4,8,19,26H,1-2,5-7,9H2,(H,20,21) |
| InChIKey | ZTOWMUQAJSSPFM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.81 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|