C19H26ClFN6O2 — CID 71175163
N-(3-chloro-4-fluorophenyl)-N'-(hydroxymethyl)-4-[[2-(2-methylpiperidin-1-yl)ethylamino]methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 71175163) has the molecular formula C19H26ClFN6O2 and a molecular weight of 424.91 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-(hydroxymethyl)-4-[[2-(2-methylpiperidin-1-yl)ethylamino]methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-(hydroxymethyl)-4-[[2-(2-methylpiperidin-1-yl)ethylamino]methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 71175163 |
| Molecular Formula | C19H26ClFN6O2 |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-(hydroxymethyl)-4-[[2-(2-methylpiperidin-1-yl)ethylamino]methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC1CCCCN1CCNCc1nonc1C(=NCO)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H26ClFN6O2/c1-13-4-2-3-8-27(13)9-7-22-11-17-18(26-29-25-17)19(23-12-28)24-14-5-6-16(21)15(20)10-14/h5-6,10,13,22,28H,2-4,7-9,11-12H2,1H3,(H,23,24) |
| InChIKey | IACARTSNHKSLIE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|