C10H8ClFN4O3 — CID 135520680
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-(hydroxymethyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 135520680) has the molecular formula C10H8ClFN4O3 and a molecular weight of 286.65 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-(hydroxymethyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-(hydroxymethyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 135520680 |
| Molecular Formula | C10H8ClFN4O3 |
| Molecular Weight | 286.65 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-4-(hydroxymethyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | OCc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C10H8ClFN4O3/c11-6-3-5(1-2-7(6)12)13-10(14-18)9-8(4-17)15-19-16-9/h1-3,17-18H,4H2,(H,13,14) |
| InChIKey | GDLQTNLSFOMZGS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.65 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|