C19H26ClFN6O — CID 89342375
N'-(3-chloro-4-fluorophenyl)-4-[[(2-methyl-2-piperidin-1-ylpropyl)amino]methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 89342375) has the molecular formula C19H26ClFN6O and a molecular weight of 408.91 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-[[(2-methyl-2-piperidin-1-ylpropyl)amino]methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-[[(2-methyl-2-piperidin-1-ylpropyl)amino]methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 89342375 |
| Molecular Formula | C19H26ClFN6O |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-[[(2-methyl-2-piperidin-1-ylpropyl)amino]methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CC(C)(CNCc1nonc1/C(N)=N/c1ccc(F)c(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C19H26ClFN6O/c1-19(2,27-8-4-3-5-9-27)12-23-11-16-17(26-28-25-16)18(22)24-13-6-7-15(21)14(20)10-13/h6-7,10,23H,3-5,8-9,11-12H2,1-2H3,(H2,22,24) |
| InChIKey | GGUMFVPYZZGEKG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|