C18H17ClFN5O — CID 89342234
N'-(3-chloro-4-fluorophenyl)-4-[[[(1S)-1-phenylethyl]amino]methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 89342234) has the molecular formula C18H17ClFN5O and a molecular weight of 373.82 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-4-[[[(1S)-1-phenylethyl]amino]methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-4-[[[(1S)-1-phenylethyl]amino]methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 89342234 |
| Molecular Formula | C18H17ClFN5O |
| Molecular Weight | 373.82 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-4-[[[(1S)-1-phenylethyl]amino]methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | C[C@H](NCc1nonc1/C(N)=N/c1ccc(F)c(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C18H17ClFN5O/c1-11(12-5-3-2-4-6-12)22-10-16-17(25-26-24-16)18(21)23-13-7-8-15(20)14(19)9-13/h2-9,11,22H,10H2,1H3,(H2,21,23)/t11-/m0/s1 |
| InChIKey | JHWHWYBAEVIPJF-NSHDSACASA-N |
| XLogP | 3.75 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|