C15H15ClFN — CID 78950457
(1S)-N-[(4-chloro-3-fluorophenyl)methyl]-1-phenylethanamine (PubChem CID 78950457) has the molecular formula C15H15ClFN and a molecular weight of 263.74 g/mol. Its IUPAC name is (1S)-N-[(4-chloro-3-fluorophenyl)methyl]-1-phenylethanamine.
| Compound Name | (1S)-N-[(4-chloro-3-fluorophenyl)methyl]-1-phenylethanamine |
|---|---|
| PubChem CID | 78950457 |
| Molecular Formula | C15H15ClFN |
| Molecular Weight | 263.74 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | (1S)-N-[(4-chloro-3-fluorophenyl)methyl]-1-phenylethanamine |
| SMILES | C[C@H](NCc1ccc(Cl)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C15H15ClFN/c1-11(13-5-3-2-4-6-13)18-10-12-7-8-14(16)15(17)9-12/h2-9,11,18H,10H2,1H3/t11-/m0/s1 |
| InChIKey | NRLLUYKBXZCUSC-NSHDSACASA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.74 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |