C18H21FN2O — CID 792533
1-[(3-fluorophenyl)methyl]-4-(2-methoxyphenyl)piperazine (PubChem CID 792533) has the molecular formula C18H21FN2O and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-4-(2-methoxyphenyl)piperazine.
| Compound Name | 1-[(3-fluorophenyl)methyl]-4-(2-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 792533 |
| Molecular Formula | C18H21FN2O |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-4-(2-methoxyphenyl)piperazine |
| SMILES | COc1ccccc1N1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H21FN2O/c1-22-18-8-3-2-7-17(18)21-11-9-20(10-12-21)14-15-5-4-6-16(19)13-15/h2-8,13H,9-12,14H2,1H3 |
| InChIKey | ZDFIYPWAJJKIPR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |