C26H35N3O2 — CID 59144676
N-cyclohexyl-3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-N-methylbenzamide (PubChem CID 59144676) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-cyclohexyl-3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-N-methylbenzamide.
| Compound Name | N-cyclohexyl-3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 59144676 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N-cyclohexyl-3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-N-methylbenzamide |
| SMILES | COc1ccccc1N1CCN(Cc2cccc(C(=O)N(C)C3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C26H35N3O2/c1-27(23-11-4-3-5-12-23)26(30)22-10-8-9-21(19-22)20-28-15-17-29(18-16-28)24-13-6-7-14-25(24)31-2/h6-10,13-14,19,23H,3-5,11-12,15-18,20H2,1-2H3 |
| InChIKey | SMFYZBFRQKAPGV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |