C24H32N4O2 — CID 46054196
[3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 46054196) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is [3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 46054196 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | COc1ccccc1N1CCN(Cc2cccc(C(=O)N3CCN(C)CC3)c2)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-25-10-14-28(15-11-25)24(29)21-7-5-6-20(18-21)19-26-12-16-27(17-13-26)22-8-3-4-9-23(22)30-2/h3-9,18H,10-17,19H2,1-2H3 |
| InChIKey | GIJHJPSXFAXSIO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |