C13H14BrFN4O2S — CID 159454956
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-methylsulfanylpropyl)-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 159454956) has the molecular formula C13H14BrFN4O2S and a molecular weight of 389.25 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-methylsulfanylpropyl)-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-methylsulfanylpropyl)-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 159454956 |
| Molecular Formula | C13H14BrFN4O2S |
| Molecular Weight | 389.25 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-(3-methylsulfanylpropyl)-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CSCCCc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C13H14BrFN4O2S/c1-22-6-2-3-11-12(19-21-18-11)13(17-20)16-8-4-5-10(15)9(14)7-8/h4-5,7,20H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | LTVRFIZQMLRLDM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|