C16H21BrFN5O3S — CID 159086182
N'-(3-bromo-4-fluorophenyl)-4-[5-(N,S-dimethylsulfonimidoyl)pentyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 159086182) has the molecular formula C16H21BrFN5O3S and a molecular weight of 462.35 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[5-(N,S-dimethylsulfonimidoyl)pentyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[5-(N,S-dimethylsulfonimidoyl)pentyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 159086182 |
| Molecular Formula | C16H21BrFN5O3S |
| Molecular Weight | 462.35 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[5-(N,S-dimethylsulfonimidoyl)pentyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CN=S(C)(=O)CCCCCc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C16H21BrFN5O3S/c1-19-27(2,25)9-5-3-4-6-14-15(23-26-22-14)16(21-24)20-11-7-8-13(18)12(17)10-11/h7-8,10,24H,3-6,9H2,1-2H3,(H,20,21) |
| InChIKey | ZIWDSWHSAXPXKF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 112.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|