C14H18BrFN6O3S — CID 159803032
N'-(3-bromo-4-fluorophenyl)-4-[3-[(ethylsulfonimidoyl)amino]propyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 159803032) has the molecular formula C14H18BrFN6O3S and a molecular weight of 449.31 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-4-[3-[(ethylsulfonimidoyl)amino]propyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-4-[3-[(ethylsulfonimidoyl)amino]propyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 159803032 |
| Molecular Formula | C14H18BrFN6O3S |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-4-[3-[(ethylsulfonimidoyl)amino]propyl]-N-hydroxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(=O)(CC)NCCCc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C14H18BrFN6O3S/c1-2-26(17,24)18-7-3-4-12-13(22-25-21-12)14(20-23)19-9-5-6-11(16)10(15)8-9/h5-6,8,23H,2-4,7H2,1H3,(H,19,20)(H2,17,18,24) |
| InChIKey | NKAQERGRHVDFMV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|