C14H16F4N6O3S — CID 157141746
N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[3-[(methylsulfonimidoyl)amino]propyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 157141746) has the molecular formula C14H16F4N6O3S and a molecular weight of 424.38 g/mol. Its IUPAC name is N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[3-[(methylsulfonimidoyl)amino]propyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[3-[(methylsulfonimidoyl)amino]propyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 157141746 |
| Molecular Formula | C14H16F4N6O3S |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[3-[(methylsulfonimidoyl)amino]propyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)NCCCc1nonc1/C(=N/c1ccc(F)c(C(F)(F)F)c1)NO |
| InChI | InChI=1S/C14H16F4N6O3S/c1-28(19,26)20-6-2-3-11-12(24-27-23-11)13(22-25)21-8-4-5-10(15)9(7-8)14(16,17)18/h4-5,7,25H,2-3,6H2,1H3,(H,21,22)(H2,19,20,26) |
| InChIKey | AKGNUDIDCRYDHH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|