C13H14F4N6O3S — CID 137199865
N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[2-(methylsulfonimidoyl)ethylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 137199865) has the molecular formula C13H14F4N6O3S and a molecular weight of 410.35 g/mol. Its IUPAC name is N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[2-(methylsulfonimidoyl)ethylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[2-(methylsulfonimidoyl)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 137199865 |
| Molecular Formula | C13H14F4N6O3S |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[2-(methylsulfonimidoyl)ethylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [H]N=S(C)(=O)CCNc1nonc1/C(=N/c1ccc(F)c(C(F)(F)F)c1)NO |
| InChI | InChI=1S/C13H14F4N6O3S/c1-27(18,25)5-4-19-11-10(22-26-23-11)12(21-24)20-7-2-3-9(14)8(6-7)13(15,16)17/h2-3,6,18,24H,4-5H2,1H3,(H,19,23)(H,20,21) |
| InChIKey | ZAIBZLGXLCEVHC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|