C14H15F4N7O5S — CID 159775426
N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[(2,2,4,4-tetradeuterio-3-hydroxy-1-sulfamoylazetidin-3-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 159775426) has the molecular formula C14H15F4N7O5S and a molecular weight of 473.40 g/mol. Its IUPAC name is N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[(2,2,4,4-tetradeuterio-3-hydroxy-1-sulfamoylazetidin-3-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[(2,2,4,4-tetradeuterio-3-hydroxy-1-sulfamoylazetidin-3-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 159775426 |
| Molecular Formula | C14H15F4N7O5S |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N'-[4-fluoro-3-(trifluoromethyl)phenyl]-N-hydroxy-4-[(2,2,4,4-tetradeuterio-3-hydroxy-1-sulfamoylazetidin-3-yl)methylamino]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | [2H]C1([2H])N(S(N)(=O)=O)C([2H])([2H])C1(O)CNc1nonc1/C(=N/c1ccc(F)c(C(F)(F)F)c1)NO |
| InChI | InChI=1S/C14H15F4N7O5S/c15-9-2-1-7(3-8(9)14(16,17)18)21-12(22-27)10-11(24-30-23-10)20-4-13(26)5-25(6-13)31(19,28)29/h1-3,26-27H,4-6H2,(H,20,24)(H,21,22)(H2,19,28,29)/i5D2,6D2 |
| InChIKey | OXNMHNDURHPYEQ-NZLXMSDQSA-N |
| XLogP | -0.05 |
| TPSA | 179.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|