C16H18BrFN6O5S — CID 157404129
N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 157404129) has the molecular formula C16H18BrFN6O5S and a molecular weight of 505.33 g/mol. Its IUPAC name is N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 157404129 |
| Molecular Formula | C16H18BrFN6O5S |
| Molecular Weight | 505.33 g/mol |
| Exact Mass | 504.02 |
| IUPAC Name | N'-(3-bromo-4-fluorophenyl)-N-hydroxy-4-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)Cc2nonc2/C(=N/c2ccc(F)c(Br)c2)NO)CC1 |
| InChI | InChI=1S/C16H18BrFN6O5S/c1-30(27,28)24-6-4-23(5-7-24)14(25)9-13-15(22-29-21-13)16(20-26)19-10-2-3-12(18)11(17)8-10/h2-3,8,26H,4-7,9H2,1H3,(H,19,20) |
| InChIKey | BNNFJAAUVKIBDL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 141.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|