C16H17ClFN5O6 — CID 142341959
3-[2-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethylamino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 142341959) has the molecular formula C16H17ClFN5O6 and a molecular weight of 429.79 g/mol. Its IUPAC name is 3-[2-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethylamino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[2-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethylamino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 142341959 |
| Molecular Formula | C16H17ClFN5O6 |
| Molecular Weight | 429.79 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 3-[2-[[4-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]oxy]ethylamino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)NCCOc1nonc1/C(=N/c1ccc(F)c(Cl)c1)NO |
| InChI | InChI=1S/C16H17ClFN5O6/c1-16(2,15(25)26)14(24)19-5-6-28-13-11(22-29-23-13)12(21-27)20-8-3-4-10(18)9(17)7-8/h3-4,7,27H,5-6H2,1-2H3,(H,19,24)(H,20,21)(H,25,26) |
| InChIKey | FDTQNPSVJUUEKY-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 159.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.79 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|