C10H14BrN7O2S — CID 123202253
4-[2-(aminosulfanylamino)ethylamino]-N'-[(4-bromofuran-2-yl)methyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 123202253) has the molecular formula C10H14BrN7O2S and a molecular weight of 376.24 g/mol. Its IUPAC name is 4-[2-(aminosulfanylamino)ethylamino]-N'-[(4-bromofuran-2-yl)methyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-[2-(aminosulfanylamino)ethylamino]-N'-[(4-bromofuran-2-yl)methyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 123202253 |
| Molecular Formula | C10H14BrN7O2S |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 4-[2-(aminosulfanylamino)ethylamino]-N'-[(4-bromofuran-2-yl)methyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NSNCCNc1nonc1/C(N)=N/Cc1cc(Br)co1 |
| InChI | InChI=1S/C10H14BrN7O2S/c11-6-3-7(19-5-6)4-15-9(12)8-10(18-20-17-8)14-1-2-16-21-13/h3,5,16H,1-2,4,13H2,(H2,12,15)(H,14,18) |
| InChIKey | OOAUPHAJPALORE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 140.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|