C11H13ClN5O3- — CID 163532374
[[(4-chlorofuran-2-yl)methylamino]-[4-(2-methoxyethylamino)-1,2,5-oxadiazol-3-yl]methylidene]azanide (PubChem CID 163532374) has the molecular formula C11H13ClN5O3- and a molecular weight of 298.71 g/mol. Its IUPAC name is [[(4-chlorofuran-2-yl)methylamino]-[4-(2-methoxyethylamino)-1,2,5-oxadiazol-3-yl]methylidene]azanide.
| Compound Name | [[(4-chlorofuran-2-yl)methylamino]-[4-(2-methoxyethylamino)-1,2,5-oxadiazol-3-yl]methylidene]azanide |
|---|---|
| PubChem CID | 163532374 |
| Molecular Formula | C11H13ClN5O3- |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | [[(4-chlorofuran-2-yl)methylamino]-[4-(2-methoxyethylamino)-1,2,5-oxadiazol-3-yl]methylidene]azanide |
| SMILES | COCCNc1nonc1C(=[N-])NCc1cc(Cl)co1 |
| InChI | InChI=1S/C11H13ClN5O3/c1-18-3-2-14-11-9(16-20-17-11)10(13)15-5-8-4-7(12)6-19-8/h4,6H,2-3,5H2,1H3,(H2-,13,14,15,17)/q-1 |
| InChIKey | DUBKRSDRGJWPML-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|