About N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine
N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine (PubChem CID 131175686) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine |
| PubChem CID | 131175686 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine |
| SMILES | COCCNc1nncc2ccoc12 |
| InChI | InChI=1S/C9H11N3O2/c1-13-5-3-10-9-8-7(2-4-14-8)6-11-12-9/h2,4,6H,3,5H2,1H3,(H,10,12) |
| InChIKey | AFBAKEBMNPEWLL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine?
The IUPAC name of N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine (CID 131175686) is N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine.
What is the SMILES notation for N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine?
The canonical SMILES for N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine is COCCNc1nncc2ccoc12.
What is the InChIKey of N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine?
The InChIKey is AFBAKEBMNPEWLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-13-5-3-10-9-8-7(2-4-14-8)6-11-12-9/h2,4,6H,3,5H2,1H3,(H,10,12).
What are the key properties of N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine?
N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine has a molecular weight of 193.21 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)furo[2,3-d]pyridazin-7-amine is sourced from PubChem (CID 131175686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).