C12H13F3N6O — CID 155366176
4-(2-aminoethylamino)-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 155366176) has the molecular formula C12H13F3N6O and a molecular weight of 314.27 g/mol. Its IUPAC name is 4-(2-aminoethylamino)-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-(2-aminoethylamino)-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 155366176 |
| Molecular Formula | C12H13F3N6O |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 4-(2-aminoethylamino)-N'-[3-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NCCNc1nonc1/C(N)=N/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N6O/c13-12(14,15)7-2-1-3-8(6-7)19-10(17)9-11(18-5-4-16)21-22-20-9/h1-3,6H,4-5,16H2,(H2,17,19)(H,18,21) |
| InChIKey | FDDPGWXGJDIKNJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|