C11H13F3N2 — CID 58663964
2-methyl-N'-[3-(trifluoromethyl)phenyl]propanimidamide (PubChem CID 58663964) has the molecular formula C11H13F3N2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-methyl-N'-[3-(trifluoromethyl)phenyl]propanimidamide.
| Compound Name | 2-methyl-N'-[3-(trifluoromethyl)phenyl]propanimidamide |
|---|---|
| PubChem CID | 58663964 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 2-methyl-N'-[3-(trifluoromethyl)phenyl]propanimidamide |
| SMILES | CC(C)/C(N)=N\c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2/c1-7(2)10(15)16-9-5-3-4-8(6-9)11(12,13)14/h3-7H,1-2H3,(H2,15,16) |
| InChIKey | KWKDNWVAXKHUCN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|