C15H16F3NO4 — CID 91287681
[(2S)-1-methoxy-1-oxopropan-2-yl] 3-[3-(trifluoromethyl)phenyl]iminobutanoate (PubChem CID 91287681) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is [(2S)-1-methoxy-1-oxopropan-2-yl] 3-[3-(trifluoromethyl)phenyl]iminobutanoate.
| Compound Name | [(2S)-1-methoxy-1-oxopropan-2-yl] 3-[3-(trifluoromethyl)phenyl]iminobutanoate |
|---|---|
| PubChem CID | 91287681 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | [(2S)-1-methoxy-1-oxopropan-2-yl] 3-[3-(trifluoromethyl)phenyl]iminobutanoate |
| SMILES | COC(=O)[C@H](C)OC(=O)C/C(C)=N/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3NO4/c1-9(7-13(20)23-10(2)14(21)22-3)19-12-6-4-5-11(8-12)15(16,17)18/h4-6,8,10H,7H2,1-3H3/b19-9+/t10-/m0/s1 |
| InChIKey | GHKJZBIYINMWFB-XPAGJJBOSA-N |
| XLogP | 3.29 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|