C14H12F3N3O — CID 154040816
4-methyl-2-oxo-N'-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboximidamide (PubChem CID 154040816) has the molecular formula C14H12F3N3O and a molecular weight of 295.26 g/mol. Its IUPAC name is 4-methyl-2-oxo-N'-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboximidamide.
| Compound Name | 4-methyl-2-oxo-N'-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 154040816 |
| Molecular Formula | C14H12F3N3O |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 4-methyl-2-oxo-N'-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboximidamide |
| SMILES | Cc1cc[nH]c(=O)c1/C(N)=N/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H12F3N3O/c1-8-5-6-19-13(21)11(8)12(18)20-10-4-2-3-9(7-10)14(15,16)17/h2-7H,1H3,(H2,18,20)(H,19,21) |
| InChIKey | QFWNXRBYECRGAF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|