C14H8F3NOS — CID 162503154
2-[3-(trifluoromethyl)phenyl]-5H-thieno[3,2-c]pyridin-4-one (PubChem CID 162503154) has the molecular formula C14H8F3NOS and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-5H-thieno[3,2-c]pyridin-4-one.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-5H-thieno[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 162503154 |
| Molecular Formula | C14H8F3NOS |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-5H-thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1[nH]ccc2sc(-c3cccc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C14H8F3NOS/c15-14(16,17)9-3-1-2-8(6-9)12-7-10-11(20-12)4-5-18-13(10)19/h1-7H,(H,18,19) |
| InChIKey | VLFDLJRNDLMKPG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |